C13H24O2Si — CID 46938779
[(1R,4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-isochromen-3-yl]oxy-trimethylsilane (PubChem CID 46938779) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is [(1R,4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-isochromen-3-yl]oxy-trimethylsilane.
| Compound Name | [(1R,4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-isochromen-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 46938779 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(1R,4aR,8aR)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-isochromen-3-yl]oxy-trimethylsilane |
| SMILES | C[C@H]1OC(O[Si](C)(C)C)=C[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H24O2Si/c1-10-12-8-6-5-7-11(12)9-13(14-10)15-16(2,3)4/h9-12H,5-8H2,1-4H3/t10-,11+,12+/m1/s1 |
| InChIKey | XGMRKHOBWYWABO-WOPDTQHZSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|