C16H9F2N3OS — CID 47056722
(E)-1-(2,4-difluorophenyl)-3-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 47056722) has the molecular formula C16H9F2N3OS and a molecular weight of 329.33 g/mol. Its IUPAC name is (E)-1-(2,4-difluorophenyl)-3-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-difluorophenyl)-3-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 47056722 |
| Molecular Formula | C16H9F2N3OS |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (E)-1-(2,4-difluorophenyl)-3-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1csc(-c2ncccn2)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H9F2N3OS/c17-10-2-4-12(13(18)8-10)14(22)5-3-11-9-23-16(21-11)15-19-6-1-7-20-15/h1-9H/b5-3+ |
| InChIKey | JCZHPMPNZPNBKP-HWKANZROSA-N |
| XLogP | 3.77 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|