C11H22N3O+ — CID 4744600
N-(4-methylpiperazin-4-ium-1-yl)cyclopentanecarboxamide (PubChem CID 4744600) has the molecular formula C11H22N3O+ and a molecular weight of 212.32 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)cyclopentanecarboxamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 4744600 |
| Molecular Formula | C11H22N3O+ |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)cyclopentanecarboxamide |
| SMILES | C[NH+]1CCN(NC(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C11H21N3O/c1-13-6-8-14(9-7-13)12-11(15)10-4-2-3-5-10/h10H,2-9H2,1H3,(H,12,15)/p+1 |
| InChIKey | GWKHHDIMIQTFON-UHFFFAOYSA-O |
| XLogP | -0.96 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |