C19H27F2N3O2 — CID 47645635
N'-(3,4-difluorophenyl)-N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]oxamide (PubChem CID 47645635) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]oxamide.
| Compound Name | N'-(3,4-difluorophenyl)-N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]oxamide |
|---|---|
| PubChem CID | 47645635 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N'-(3,4-difluorophenyl)-N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]oxamide |
| SMILES | CC1CCCN(CCCCNC(=O)C(=O)N(C)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H27F2N3O2/c1-14-6-5-11-24(13-14)10-4-3-9-22-18(25)19(26)23(2)15-7-8-16(20)17(21)12-15/h7-8,12,14H,3-6,9-11,13H2,1-2H3,(H,22,25) |
| InChIKey | HBEXKXHADJWLAY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|