C19H17N5O4S — CID 4845818
N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide (PubChem CID 4845818) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide.
| Compound Name | N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 4845818 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)NNC(=S)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H17N5O4S/c20-8-7-17(25)22-14-4-2-13(3-5-14)18(26)23-24-19(29)21-10-12-1-6-15-16(9-12)28-11-27-15/h1-6,9H,7,10-11H2,(H,22,25)(H,23,26)(H2,21,24,29) |
| InChIKey | UDDKKNSGWPSNBW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|