About N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide
N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide (PubChem CID 4845818) has the molecular formula C19H17N5O4S
and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide.
Molecular Properties
| Compound Name | N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide |
| PubChem CID | 4845818 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)NNC(=S)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H17N5O4S/c20-8-7-17(25)22-14-4-2-13(3-5-14)18(26)23-24-19(29)21-10-12-1-6-15-16(9-12)28-11-27-15/h1-6,9H,7,10-11H2,(H,22,25)(H,23,26)(H2,21,24,29) |
| InChIKey | UDDKKNSGWPSNBW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide?
The IUPAC name of N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide (CID 4845818) is N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide.
What is the SMILES notation for N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide?
The canonical SMILES for N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide is N#CCC(=O)Nc1ccc(C(=O)NNC(=S)NCc2ccc3c(c2)OCO3)cc1.
What is the InChIKey of N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide?
The InChIKey is UDDKKNSGWPSNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O4S/c20-8-7-17(25)22-14-4-2-13(3-5-14)18(26)23-24-19(29)21-10-12-1-6-15-16(9-12)28-11-27-15/h1-6,9H,7,10-11H2,(H,22,25)(H,23,26)(H2,21,24,29).
What are the key properties of N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide?
N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide has a molecular weight of 411.44 g/mol, XLogP of 1.58, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1,3-benzodioxol-5-ylmethylcarbamothioylamino)carbamoyl]phenyl]-2-cyanoacetamide is sourced from PubChem (CID 4845818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).