C17H28O4 — CID 4867541
[2-hydroxy-2-(hydroxymethyl)-5,5,6b-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-1a-yl]methyl acetate (PubChem CID 4867541) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [2-hydroxy-2-(hydroxymethyl)-5,5,6b-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-1a-yl]methyl acetate.
| Compound Name | [2-hydroxy-2-(hydroxymethyl)-5,5,6b-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-1a-yl]methyl acetate |
|---|---|
| PubChem CID | 4867541 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [2-hydroxy-2-(hydroxymethyl)-5,5,6b-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-1a-yl]methyl acetate |
| SMILES | CC(=O)OCC12CC1(C)C1CC(C)(C)CC1CC2(O)CO |
| InChI | InChI=1S/C17H28O4/c1-11(19)21-10-16-8-15(16,4)13-7-14(2,3)5-12(13)6-17(16,20)9-18/h12-13,18,20H,5-10H2,1-4H3 |
| InChIKey | AIDZBPIBBVPRNL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |