C26H27NO4 — CID 505586
tert-butyl 4-[benzyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate (PubChem CID 505586) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl 4-[benzyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[benzyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505586 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | tert-butyl 4-[benzyl(naphthalen-2-ylmethyl)amino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccccc1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H27NO4/c1-26(2,3)31-25(30)23(28)16-24(29)27(17-19-9-5-4-6-10-19)18-20-13-14-21-11-7-8-12-22(21)15-20/h4-15H,16-18H2,1-3H3 |
| InChIKey | JHNOIFPKKGMRBC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|