C19H20NO3+ — CID 5057073
11,11-dimethylspiro[3,5-dioxa-11-azoniatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 5057073) has the molecular formula C19H20NO3+ and a molecular weight of 310.37 g/mol. Its IUPAC name is 11,11-dimethylspiro[3,5-dioxa-11-azoniatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | 11,11-dimethylspiro[3,5-dioxa-11-azoniatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 5057073 |
| Molecular Formula | C19H20NO3+ |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 11,11-dimethylspiro[3,5-dioxa-11-azoniatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | C[N+]1(C)CCc2cc3c(c4c2C1CC41C=CC(=O)C=C1)OCO3 |
| InChI | InChI=1S/C19H20NO3/c1-20(2)8-5-12-9-15-18(23-11-22-15)17-16(12)14(20)10-19(17)6-3-13(21)4-7-19/h3-4,6-7,9,14H,5,8,10-11H2,1-2H3/q+1 |
| InChIKey | RVOABZNUOQKMAL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|