C37H47NO6S2 — CID 5078652
N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide (PubChem CID 5078652) has the molecular formula C37H47NO6S2 and a molecular weight of 665.92 g/mol. Its IUPAC name is N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide.
| Compound Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 5078652 |
| Molecular Formula | C37H47NO6S2 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-N-(3-methoxypropyl)thiophene-2-sulfonamide |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccccc3)CC(O)CCC(C)=CCCC21C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C37H47NO6S2/c1-27-10-7-19-36(2)33(18-20-37(36,41)26-38(21-9-22-44-3)46(42,43)34-13-8-23-45-34)31-17-15-28(24-30(39)16-14-27)25-32(31)35(40)29-11-5-4-6-12-29/h4-6,8,10-13,15,17,23,25,30,33,39,41H,7,9,14,16,18-22,24,26H2,1-3H3 |
| InChIKey | JIQOGDKLVDIDRQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|