About bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine
bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine (PubChem CID 50911470) has the molecular formula C18H26BrClN2Sn
and a molecular weight of 504.49 g/mol. Its IUPAC name is bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine |
| PubChem CID | 50911470 |
| Molecular Formula | C18H26BrClN2Sn |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine |
| SMILES | CCCC[Sn](Cl)(Br)CCCC.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C4H9.BrH.ClH.Sn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-3-4-2;;;/h1-8H;2*1,3-4H2,2H3;2*1H;/q;;;;;+2/p-2 |
| InChIKey | DZJPVTUWSMXNEK-UHFFFAOYSA-L |
| XLogP | 6.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine?
The IUPAC name of bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine (CID 50911470) is bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine.
What is the SMILES notation for bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine?
The canonical SMILES for bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine is CCCC[Sn](Cl)(Br)CCCC.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine?
The InChIKey is DZJPVTUWSMXNEK-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8N2.2C4H9.BrH.ClH.Sn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-3-4-2;;;/h1-8H;2*1,3-4H2,2H3;2*1H;/q;;;;;+2/p-2.
What are the key properties of bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine?
bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine has a molecular weight of 504.49 g/mol, XLogP of 6.81, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-dibutyl-chlorostannane;2-pyridin-2-ylpyridine is sourced from PubChem (CID 50911470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).