C14H15IO2 — CID 50916450
2-iodo-1,5-dimethoxy-3-methyl-4-(3-methylbut-3-en-1-ynyl)benzene (PubChem CID 50916450) has the molecular formula C14H15IO2 and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-iodo-1,5-dimethoxy-3-methyl-4-(3-methylbut-3-en-1-ynyl)benzene.
| Compound Name | 2-iodo-1,5-dimethoxy-3-methyl-4-(3-methylbut-3-en-1-ynyl)benzene |
|---|---|
| PubChem CID | 50916450 |
| Molecular Formula | C14H15IO2 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-iodo-1,5-dimethoxy-3-methyl-4-(3-methylbut-3-en-1-ynyl)benzene |
| SMILES | C=C(C)C#Cc1c(OC)cc(OC)c(I)c1C |
| InChI | InChI=1S/C14H15IO2/c1-9(2)6-7-11-10(3)14(15)13(17-5)8-12(11)16-4/h8H,1H2,2-5H3 |
| InChIKey | ZMJCEFSQPVODHK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|