C15H23N3O5S — CID 50991087
3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 4-hydroxy-3,5-dimethoxybenzoate (PubChem CID 50991087) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 4-hydroxy-3,5-dimethoxybenzoate.
| Compound Name | 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 4-hydroxy-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 50991087 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 4-hydroxy-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCC/N=C(\N)NCCS)cc(OC)c1O |
| InChI | InChI=1S/C15H23N3O5S/c1-21-11-8-10(9-12(22-2)13(11)19)14(20)23-6-3-4-17-15(16)18-5-7-24/h8-9,19,24H,3-7H2,1-2H3,(H3,16,17,18) |
| InChIKey | PZMNXCCXYWATFG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|