C22H29N3O5S — CID 141344074
3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 3,5-dimethoxy-4-phenylmethoxybenzoate (PubChem CID 141344074) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 3,5-dimethoxy-4-phenylmethoxybenzoate.
| Compound Name | 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 3,5-dimethoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 141344074 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-[[amino-(2-sulfanylethylamino)methylidene]amino]propyl 3,5-dimethoxy-4-phenylmethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCC/N=C(\N)NCCS)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-27-18-13-17(21(26)29-11-6-9-24-22(23)25-10-12-31)14-19(28-2)20(18)30-15-16-7-4-3-5-8-16/h3-5,7-8,13-14,31H,6,9-12,15H2,1-2H3,(H3,23,24,25) |
| InChIKey | BBNMIEDOTXIBGD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|