C8H3F6NaO2S — CID 50998719
sodium 3,5-bis(trifluoromethyl)benzenesulfinate (PubChem CID 50998719) has the molecular formula C8H3F6NaO2S and a molecular weight of 300.16 g/mol. Its IUPAC name is sodium 3,5-bis(trifluoromethyl)benzenesulfinate.
| Compound Name | sodium 3,5-bis(trifluoromethyl)benzenesulfinate |
|---|---|
| PubChem CID | 50998719 |
| Molecular Formula | C8H3F6NaO2S |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | sodium 3,5-bis(trifluoromethyl)benzenesulfinate |
| SMILES | O=S([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C8H4F6O2S.Na/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)17(15)16;/h1-3H,(H,15,16);/q;+1/p-1 |
| InChIKey | AOAHGENMKUFVHL-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|