C25H23Cl2FN4O3S — CID 51029537
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-methylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-amine (PubChem CID 51029537) has the molecular formula C25H23Cl2FN4O3S and a molecular weight of 549.46 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-methylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-methylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 51029537 |
| Molecular Formula | C25H23Cl2FN4O3S |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(2-methylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-7-yl)pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c4c([nH]c3c2)CCN(S(C)(=O)=O)C4)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H23Cl2FN4O3S/c1-13(23-18(26)5-6-19(28)24(23)27)35-22-10-15(11-30-25(22)29)14-3-4-16-17-12-32(36(2,33)34)8-7-20(17)31-21(16)9-14/h3-6,9-11,13,31H,7-8,12H2,1-2H3,(H2,29,30)/t13-/m1/s1 |
| InChIKey | XUCFDFFKQAPSKV-CYBMUJFWSA-N |
| XLogP | 5.72 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|