C27H26Cl2FN5O2 — CID 51029710
7-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N,N-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 51029710) has the molecular formula C27H26Cl2FN5O2 and a molecular weight of 542.44 g/mol. Its IUPAC name is 7-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N,N-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 7-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N,N-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 51029710 |
| Molecular Formula | C27H26Cl2FN5O2 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 7-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N,N-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c4c([nH]c3c2)CCN(C(=O)N(C)C)C4)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H26Cl2FN5O2/c1-14(24-19(28)6-7-20(30)25(24)29)37-23-11-16(12-32-26(23)31)15-4-5-17-18-13-35(27(36)34(2)3)9-8-21(18)33-22(17)10-15/h4-7,10-12,14,33H,8-9,13H2,1-3H3,(H2,31,32)/t14-/m1/s1 |
| InChIKey | NWGLKPFCJFOMTM-CQSZACIVSA-N |
| XLogP | 6.44 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|