C30H31Cl2FN4O — CID 51030728
5-(2-cyclohexyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 51030728) has the molecular formula C30H31Cl2FN4O and a molecular weight of 553.51 g/mol. Its IUPAC name is 5-(2-cyclohexyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-(2-cyclohexyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 51030728 |
| Molecular Formula | C30H31Cl2FN4O |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 5-(2-cyclohexyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-8-yl)-3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2ccc3[nH]c4c(c3c2)CN(C2CCCCC2)CC4)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C30H31Cl2FN4O/c1-17(28-23(31)8-9-24(33)29(28)32)38-27-14-19(15-35-30(27)34)18-7-10-25-21(13-18)22-16-37(12-11-26(22)36-25)20-5-3-2-4-6-20/h7-10,13-15,17,20,36H,2-6,11-12,16H2,1H3,(H2,34,35)/t17-/m1/s1 |
| InChIKey | XEMKHSSWHSCAJZ-QGZVFWFLSA-N |
| XLogP | 8.09 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|