C13H12Cl2N8 — CID 51352497
2-[2-amino-9-[(3,4-dichlorophenyl)methyl]purin-6-yl]guanidine (PubChem CID 51352497) has the molecular formula C13H12Cl2N8 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-[2-amino-9-[(3,4-dichlorophenyl)methyl]purin-6-yl]guanidine.
| Compound Name | 2-[2-amino-9-[(3,4-dichlorophenyl)methyl]purin-6-yl]guanidine |
|---|---|
| PubChem CID | 51352497 |
| Molecular Formula | C13H12Cl2N8 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[2-amino-9-[(3,4-dichlorophenyl)methyl]purin-6-yl]guanidine |
| SMILES | NC(N)=Nc1nc(N)nc2c1ncn2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N8/c14-7-2-1-6(3-8(7)15)4-23-5-19-9-10(20-12(16)17)21-13(18)22-11(9)23/h1-3,5H,4H2,(H6,16,17,18,20,21,22) |
| InChIKey | QHQGQHAYYNJREN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|