C15H14N3O+ — CID 51403072
5-(1-methylpyridin-1-ium-4-yl)-4-phenyl-1,2-dihydropyrazol-3-one (PubChem CID 51403072) has the molecular formula C15H14N3O+ and a molecular weight of 252.30 g/mol. Its IUPAC name is 5-(1-methylpyridin-1-ium-4-yl)-4-phenyl-1,2-dihydropyrazol-3-one.
| Compound Name | 5-(1-methylpyridin-1-ium-4-yl)-4-phenyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 51403072 |
| Molecular Formula | C15H14N3O+ |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5-(1-methylpyridin-1-ium-4-yl)-4-phenyl-1,2-dihydropyrazol-3-one |
| SMILES | C[n+]1ccc(-c2[nH][nH]c(=O)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H13N3O/c1-18-9-7-12(8-10-18)14-13(15(19)17-16-14)11-5-3-2-4-6-11/h2-10,19H,1H3/p+1 |
| InChIKey | ACLIJOBPOIFOEW-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 52.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|