C14H14N3O+ — CID 139721034
1,5-dimethyl-6-phenyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one (PubChem CID 139721034) has the molecular formula C14H14N3O+ and a molecular weight of 240.29 g/mol. Its IUPAC name is 1,5-dimethyl-6-phenyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one.
| Compound Name | 1,5-dimethyl-6-phenyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one |
|---|---|
| PubChem CID | 139721034 |
| Molecular Formula | C14H14N3O+ |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1,5-dimethyl-6-phenyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one |
| SMILES | Cc1c(-c2ccccc2)[nH]c(=O)c2n1cc[n+]2C |
| InChI | InChI=1S/C14H13N3O/c1-10-12(11-6-4-3-5-7-11)15-13(18)14-16(2)8-9-17(10)14/h3-9H,1-2H3/p+1 |
| InChIKey | RCKHRPHTJYPBKC-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|