C23H23BrO5 — CID 51506589
ethyl (3S,4S)-4-[(1S)-2-(4-bromophenyl)-2-oxo-1-phenylethyl]-5,5-dimethyl-2-oxooxolane-3-carboxylate (PubChem CID 51506589) has the molecular formula C23H23BrO5 and a molecular weight of 459.34 g/mol. Its IUPAC name is ethyl (3S,4S)-4-[(1S)-2-(4-bromophenyl)-2-oxo-1-phenylethyl]-5,5-dimethyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3S,4S)-4-[(1S)-2-(4-bromophenyl)-2-oxo-1-phenylethyl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 51506589 |
| Molecular Formula | C23H23BrO5 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | ethyl (3S,4S)-4-[(1S)-2-(4-bromophenyl)-2-oxo-1-phenylethyl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)OC(C)(C)[C@H]1[C@H](C(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23BrO5/c1-4-28-21(26)18-19(23(2,3)29-22(18)27)17(14-8-6-5-7-9-14)20(25)15-10-12-16(24)13-11-15/h5-13,17-19H,4H2,1-3H3/t17-,18+,19+/m1/s1 |
| InChIKey | HRTBRYMNZPESET-QYZOEREBSA-N |
| XLogP | 4.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|