C9H11N2OS+ — CID 51674967
4-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-amine (PubChem CID 51674967) has the molecular formula C9H11N2OS+ and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-amine.
| Compound Name | 4-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 51674967 |
| Molecular Formula | C9H11N2OS+ |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 4-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-amine |
| SMILES | COc1cccc2sc(N)[n+](C)c12 |
| InChI | InChI=1S/C9H10N2OS/c1-11-8-6(12-2)4-3-5-7(8)13-9(11)10/h3-5,10H,1-2H3/p+1 |
| InChIKey | CBSRIQYPJRDWTC-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 39.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|