C27H26ClN3O4 — CID 5225053
3-(3-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-1-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]urea (PubChem CID 5225053) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-1-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-1-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 5225053 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-1-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]urea |
| SMILES | COc1ccccc1CCN(C(=O)Nc1cccc(Cl)c1)C1CC(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C27H26ClN3O4/c1-18-10-12-22(13-11-18)31-25(32)17-23(26(31)33)30(15-14-19-6-3-4-9-24(19)35-2)27(34)29-21-8-5-7-20(28)16-21/h3-13,16,23H,14-15,17H2,1-2H3,(H,29,34) |
| InChIKey | KVBPCYGGIYQWGP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|