C15H16N6O5 — CID 5238839
2-(4,5-dinitroimidazol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 5238839) has the molecular formula C15H16N6O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-(4,5-dinitroimidazol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4,5-dinitroimidazol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 5238839 |
| Molecular Formula | C15H16N6O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(4,5-dinitroimidazol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-])N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H16N6O5/c22-13(10-19-11-16-14(20(23)24)15(19)21(25)26)18-8-6-17(7-9-18)12-4-2-1-3-5-12/h1-5,11H,6-10H2 |
| InChIKey | DECRIIONZNSPTF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 127.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|