C20H21FN2O4 — CID 52658460
3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-cyclopropyl-1-[(4-fluorophenyl)methyl]urea (PubChem CID 52658460) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-cyclopropyl-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-cyclopropyl-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 52658460 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-cyclopropyl-1-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCCOc1ccc2c(c1)OCO2)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C20H21FN2O4/c21-15-3-1-14(2-4-15)12-23(16-5-6-16)20(24)22-9-10-25-17-7-8-18-19(11-17)27-13-26-18/h1-4,7-8,11,16H,5-6,9-10,12-13H2,(H,22,24) |
| InChIKey | MESYKFJZCAOMGN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|