C24H42O5Si2 — CID 5271318
(6aS,8R,9R,9aS)-9-methoxy-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 5271318) has the molecular formula C24H42O5Si2 and a molecular weight of 466.77 g/mol. Its IUPAC name is (6aS,8R,9R,9aS)-9-methoxy-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aS,8R,9R,9aS)-9-methoxy-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 5271318 |
| Molecular Formula | C24H42O5Si2 |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (6aS,8R,9R,9aS)-9-methoxy-8-phenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CO[C@H]1[C@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@@H]2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H42O5Si2/c1-16(2)30(17(3)4)26-15-21-23(28-31(29-30,18(5)6)19(7)8)24(25-9)22(27-21)20-13-11-10-12-14-20/h10-14,16-19,21-24H,15H2,1-9H3/t21-,22+,23-,24+/m0/s1 |
| InChIKey | GLMCDPHZYLGOAQ-UARRHKHWSA-N |
| XLogP | 6.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|