C13H24N+ — CID 5276621
(3,5-dimethyl-1-adamantyl)-methylazanium (PubChem CID 5276621) has the molecular formula C13H24N+ and a molecular weight of 194.34 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-methylazanium.
| Compound Name | (3,5-dimethyl-1-adamantyl)-methylazanium |
|---|---|
| PubChem CID | 5276621 |
| Molecular Formula | C13H24N+ |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-methylazanium |
| SMILES | C[NH2+]C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C13H23N/c1-11-4-10-5-12(2,7-11)9-13(6-10,8-11)14-3/h10,14H,4-9H2,1-3H3/p+1 |
| InChIKey | FQPYRWAIWQNTFQ-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |