C19H35NO7P2 — CID 52914865
2-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethyl-methylamino]ethyl phosphono hydrogen phosphate (PubChem CID 52914865) has the molecular formula C19H35NO7P2 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethyl-methylamino]ethyl phosphono hydrogen phosphate.
| Compound Name | 2-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethyl-methylamino]ethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 52914865 |
| Molecular Formula | C19H35NO7P2 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethyl-methylamino]ethyl phosphono hydrogen phosphate |
| SMILES | C=C1C=C[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCN(C)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C19H35NO7P2/c1-15-7-8-17-18(2,3)10-6-11-19(17,4)16(15)9-12-20(5)13-14-26-29(24,25)27-28(21,22)23/h7-8,16-17H,1,6,9-14H2,2-5H3,(H,24,25)(H2,21,22,23)/t16-,17-,19+/m0/s1 |
| InChIKey | JYGIQAFZJDOJCP-JENIJYKNSA-N |
| XLogP | 4.11 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|