About 9bH-perimidin-2-amine;hydrobromide
9bH-perimidin-2-amine;hydrobromide (PubChem CID 52953965) has the molecular formula C11H10BrN3
and a molecular weight of 264.13 g/mol. Its IUPAC name is 9bH-perimidin-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 9bH-perimidin-2-amine;hydrobromide |
| PubChem CID | 52953965 |
| Molecular Formula | C11H10BrN3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 9bH-perimidin-2-amine;hydrobromide |
| SMILES | Br.NC1=NC2=CC=CC3=CC=CC(=N1)C32 |
| InChI | InChI=1S/C11H9N3.BrH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6,10H,(H2,12,13,14);1H |
| InChIKey | CULFGGKGOQPHOD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9bH-perimidin-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9bH-perimidin-2-amine;hydrobromide?
The IUPAC name of 9bH-perimidin-2-amine;hydrobromide (CID 52953965) is 9bH-perimidin-2-amine;hydrobromide.
What is the SMILES notation for 9bH-perimidin-2-amine;hydrobromide?
The canonical SMILES for 9bH-perimidin-2-amine;hydrobromide is Br.NC1=NC2=CC=CC3=CC=CC(=N1)C32.
What is the InChIKey of 9bH-perimidin-2-amine;hydrobromide?
The InChIKey is CULFGGKGOQPHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3.BrH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6,10H,(H2,12,13,14);1H.
What are the key properties of 9bH-perimidin-2-amine;hydrobromide?
9bH-perimidin-2-amine;hydrobromide has a molecular weight of 264.13 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9bH-perimidin-2-amine;hydrobromide is sourced from PubChem (CID 52953965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).