C15H10O2 — CID 10466110
9bH-phenalene-1,2-dicarbaldehyde (PubChem CID 10466110) has the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 9bH-phenalene-1,2-dicarbaldehyde.
| Compound Name | 9bH-phenalene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 10466110 |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 9bH-phenalene-1,2-dicarbaldehyde |
| SMILES | O=CC1=CC2=CC=CC3=CC=CC(=C1C=O)C32 |
| InChI | InChI=1S/C15H10O2/c16-8-12-7-11-5-1-3-10-4-2-6-13(15(10)11)14(12)9-17/h1-9,15H |
| InChIKey | VAMRJSXVUHYUFA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|