C17H31NO4 — CID 5315247
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 2,3-dihydroxy-2-(2-methylpropyl)pentanoate (PubChem CID 5315247) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 2,3-dihydroxy-2-(2-methylpropyl)pentanoate.
| Compound Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 2,3-dihydroxy-2-(2-methylpropyl)pentanoate |
|---|---|
| PubChem CID | 5315247 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 2,3-dihydroxy-2-(2-methylpropyl)pentanoate |
| SMILES | CCC(O)C(O)(CC(C)C)C(=O)OCC1CCN2CCCC12 |
| InChI | InChI=1S/C17H31NO4/c1-4-15(19)17(21,10-12(2)3)16(20)22-11-13-7-9-18-8-5-6-14(13)18/h12-15,19,21H,4-11H2,1-3H3 |
| InChIKey | RHBBQERWZVVUFF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |