C18H29NO6 — CID 163026901
1-O-[[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 4-O-methyl (2S)-2-acetyloxy-2-propan-2-ylbutanedioate (PubChem CID 163026901) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-O-[[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 4-O-methyl (2S)-2-acetyloxy-2-propan-2-ylbutanedioate.
| Compound Name | 1-O-[[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 4-O-methyl (2S)-2-acetyloxy-2-propan-2-ylbutanedioate |
|---|---|
| PubChem CID | 163026901 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-O-[[(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 4-O-methyl (2S)-2-acetyloxy-2-propan-2-ylbutanedioate |
| SMILES | COC(=O)C[C@@](OC(C)=O)(C(=O)OC[C@H]1CCN2CCC[C@H]12)C(C)C |
| InChI | InChI=1S/C18H29NO6/c1-12(2)18(25-13(3)20,10-16(21)23-4)17(22)24-11-14-7-9-19-8-5-6-15(14)19/h12,14-15H,5-11H2,1-4H3/t14-,15-,18+/m1/s1 |
| InChIKey | GVGQSWNPUJRFFZ-RKVPGOIHSA-N |
| XLogP | 1.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|