C19H24O2S — CID 531730
1-adamantylmethyl 2-phenylsulfanylacetate (PubChem CID 531730) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-adamantylmethyl 2-phenylsulfanylacetate.
| Compound Name | 1-adamantylmethyl 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 531730 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-adamantylmethyl 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24O2S/c20-18(12-22-17-4-2-1-3-5-17)21-13-19-9-14-6-15(10-19)8-16(7-14)11-19/h1-5,14-16H,6-13H2 |
| InChIKey | OBBPJCYJLUECGQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |