C10H8BrNO3S2 — CID 53271253
ethyl 5-(5-bromofuran-2-yl)-2-sulfanylidene-3H-1,3-thiazole-4-carboxylate (PubChem CID 53271253) has the molecular formula C10H8BrNO3S2 and a molecular weight of 334.22 g/mol. Its IUPAC name is ethyl 5-(5-bromofuran-2-yl)-2-sulfanylidene-3H-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(5-bromofuran-2-yl)-2-sulfanylidene-3H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 53271253 |
| Molecular Formula | C10H8BrNO3S2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 332.91 |
| IUPAC Name | ethyl 5-(5-bromofuran-2-yl)-2-sulfanylidene-3H-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(=S)sc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C10H8BrNO3S2/c1-2-14-9(13)7-8(17-10(16)12-7)5-3-4-6(11)15-5/h3-4H,2H2,1H3,(H,12,16) |
| InChIKey | UKGPGTZBTCTNGH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|