C9H10F9NOS — CID 53342829
(NE)-N-(2,2-dimethylpropylidene)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide (PubChem CID 53342829) has the molecular formula C9H10F9NOS and a molecular weight of 351.23 g/mol. Its IUPAC name is (NE)-N-(2,2-dimethylpropylidene)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide.
| Compound Name | (NE)-N-(2,2-dimethylpropylidene)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
|---|---|
| PubChem CID | 53342829 |
| Molecular Formula | C9H10F9NOS |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (NE)-N-(2,2-dimethylpropylidene)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinamide |
| SMILES | CC(C)(C)/C=N/S(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NOS/c1-5(2,3)4-19-21(20)9(17,18)7(12,13)6(10,11)8(14,15)16/h4H,1-3H3/b19-4+ |
| InChIKey | BAQIGNUEYYZVFH-RMOCHZDMSA-N |
| XLogP | 4.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|