C14H21N7O4 — CID 53344784
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E)-2-(2-methylpropylidene)hydrazinyl]oxymethyl]oxolane-3,4-diol (PubChem CID 53344784) has the molecular formula C14H21N7O4 and a molecular weight of 351.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E)-2-(2-methylpropylidene)hydrazinyl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E)-2-(2-methylpropylidene)hydrazinyl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 53344784 |
| Molecular Formula | C14H21N7O4 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E)-2-(2-methylpropylidene)hydrazinyl]oxymethyl]oxolane-3,4-diol |
| SMILES | CC(C)/C=N/NOC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N7O4/c1-7(2)3-19-20-24-4-8-10(22)11(23)14(25-8)21-6-18-9-12(15)16-5-17-13(9)21/h3,5-8,10-11,14,20,22-23H,4H2,1-2H3,(H2,15,16,17)/b19-3+/t8-,10-,11-,14-/m1/s1 |
| InChIKey | QQHOJHNIPYBIRQ-WNSDBVTISA-N |
| XLogP | -0.81 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|