C17H16O3 — CID 53344995
5-(4-phenylbut-1-en-2-yl)-1,3-benzodioxol-4-ol (PubChem CID 53344995) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5-(4-phenylbut-1-en-2-yl)-1,3-benzodioxol-4-ol.
| Compound Name | 5-(4-phenylbut-1-en-2-yl)-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 53344995 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-(4-phenylbut-1-en-2-yl)-1,3-benzodioxol-4-ol |
| SMILES | C=C(CCc1ccccc1)c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C17H16O3/c1-12(7-8-13-5-3-2-4-6-13)14-9-10-15-17(16(14)18)20-11-19-15/h2-6,9-10,18H,1,7-8,11H2 |
| InChIKey | FZVSHKIVKXVVLO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |