C24H29F3NO13PS2 — CID 53353743
[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethoxy)phenyl]ethoxy]methyl diethyl phosphate;sulfuric acid (PubChem CID 53353743) has the molecular formula C24H29F3NO13PS2 and a molecular weight of 691.59 g/mol. Its IUPAC name is [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethoxy)phenyl]ethoxy]methyl diethyl phosphate;sulfuric acid.
| Compound Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethoxy)phenyl]ethoxy]methyl diethyl phosphate;sulfuric acid |
|---|---|
| PubChem CID | 53353743 |
| Molecular Formula | C24H29F3NO13PS2 |
| Molecular Weight | 691.59 g/mol |
| Exact Mass | 691.08 |
| IUPAC Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethoxy)phenyl]ethoxy]methyl diethyl phosphate;sulfuric acid |
| SMILES | CCOP(=O)(OCC)OCOC(COc1ccc(CC2SC(=O)NC2=O)cc1)c1cccc(OC(F)(F)F)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C24H27F3NO9PS.H2O4S/c1-3-34-38(31,35-4-2)36-15-33-20(17-6-5-7-19(13-17)37-24(25,26)27)14-32-18-10-8-16(9-11-18)12-21-22(29)28-23(30)39-21;1-5(2,3)4/h5-11,13,20-21H,3-4,12,14-15H2,1-2H3,(H,28,29,30);(H2,1,2,3,4) |
| InChIKey | IPZYPSWKJQOXEJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 193.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|