C12H18F2N2O4S4 — CID 53380509
S-(fluoromethyl) 2-acetamido-3-[[2-acetamido-3-(fluoromethylsulfanyl)-3-oxopropyl]disulfanyl]propanethioate (PubChem CID 53380509) has the molecular formula C12H18F2N2O4S4 and a molecular weight of 420.55 g/mol. Its IUPAC name is S-(fluoromethyl) 2-acetamido-3-[[2-acetamido-3-(fluoromethylsulfanyl)-3-oxopropyl]disulfanyl]propanethioate.
| Compound Name | S-(fluoromethyl) 2-acetamido-3-[[2-acetamido-3-(fluoromethylsulfanyl)-3-oxopropyl]disulfanyl]propanethioate |
|---|---|
| PubChem CID | 53380509 |
| Molecular Formula | C12H18F2N2O4S4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | S-(fluoromethyl) 2-acetamido-3-[[2-acetamido-3-(fluoromethylsulfanyl)-3-oxopropyl]disulfanyl]propanethioate |
| SMILES | CC(=O)NC(CSSCC(NC(C)=O)C(=O)SCF)C(=O)SCF |
| InChI | InChI=1S/C12H18F2N2O4S4/c1-7(17)15-9(11(19)21-5-13)3-23-24-4-10(16-8(2)18)12(20)22-6-14/h9-10H,3-6H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | XEGKDXHFNJQVNY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|