C25H40O4S2Si — CID 53381186
(8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-9-oxa-1,5-dithiaspiro[5.5]undecan-10-one (PubChem CID 53381186) has the molecular formula C25H40O4S2Si and a molecular weight of 496.81 g/mol. Its IUPAC name is (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-9-oxa-1,5-dithiaspiro[5.5]undecan-10-one.
| Compound Name | (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-9-oxa-1,5-dithiaspiro[5.5]undecan-10-one |
|---|---|
| PubChem CID | 53381186 |
| Molecular Formula | C25H40O4S2Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-9-oxa-1,5-dithiaspiro[5.5]undecan-10-one |
| SMILES | C[C@@H](OCc1ccccc1)[C@@H](C[C@@H]1CC2(CC(=O)O1)SCCCS2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O4S2Si/c1-19(27-18-20-11-8-7-9-12-20)22(29-32(5,6)24(2,3)4)15-21-16-25(17-23(26)28-21)30-13-10-14-31-25/h7-9,11-12,19,21-22H,10,13-18H2,1-6H3/t19-,21-,22-/m1/s1 |
| InChIKey | FKXOYLVCBSNAAW-CEMLEFRQSA-N |
| XLogP | 6.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|