C14H18O5 — CID 53381344
(3R,3aS,7aS)-7-methyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1,5-dione (PubChem CID 53381344) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (3R,3aS,7aS)-7-methyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1,5-dione.
| Compound Name | (3R,3aS,7aS)-7-methyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1,5-dione |
|---|---|
| PubChem CID | 53381344 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (3R,3aS,7aS)-7-methyl-3-[(2-methyl-1,3-dioxolan-2-yl)methyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1,5-dione |
| SMILES | CC1=CC(=O)C[C@H]2[C@@H]1C(=O)O[C@@H]2CC1(C)OCCO1 |
| InChI | InChI=1S/C14H18O5/c1-8-5-9(15)6-10-11(19-13(16)12(8)10)7-14(2)17-3-4-18-14/h5,10-12H,3-4,6-7H2,1-2H3/t10-,11-,12-/m1/s1 |
| InChIKey | RPDXPEHSPXBZAZ-IJLUTSLNSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |