C6H9N3O3 — CID 53437738
N-methyl-3,6-dioxopiperazine-2-carboxamide (PubChem CID 53437738) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is N-methyl-3,6-dioxopiperazine-2-carboxamide.
| Compound Name | N-methyl-3,6-dioxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 53437738 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | N-methyl-3,6-dioxopiperazine-2-carboxamide |
| SMILES | CNC(=O)C1NC(=O)CNC1=O |
| InChI | InChI=1S/C6H9N3O3/c1-7-5(11)4-6(12)8-2-3(10)9-4/h4H,2H2,1H3,(H,7,11)(H,8,12)(H,9,10) |
| InChIKey | PSHNARPRUUVFHS-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|