About 2-hydroperoxyacetamide
2-hydroperoxyacetamide (PubChem CID 53437904) has the molecular formula C2H5NO3
and a molecular weight of 91.07 g/mol. Its IUPAC name is 2-hydroperoxyacetamide.
Molecular Properties
| Compound Name | 2-hydroperoxyacetamide |
| PubChem CID | 53437904 |
| Molecular Formula | C2H5NO3 |
| Molecular Weight | 91.07 g/mol |
| Exact Mass | 91.03 |
| IUPAC Name | 2-hydroperoxyacetamide |
| SMILES | NC(=O)COO |
| InChI | InChI=1S/C2H5NO3/c3-2(4)1-6-5/h5H,1H2,(H2,3,4) |
| InChIKey | PIXUMRYEAGBBSA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.07 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxyacetamide?
The IUPAC name of 2-hydroperoxyacetamide (CID 53437904) is 2-hydroperoxyacetamide.
What is the SMILES notation for 2-hydroperoxyacetamide?
The canonical SMILES for 2-hydroperoxyacetamide is NC(=O)COO.
What is the InChIKey of 2-hydroperoxyacetamide?
The InChIKey is PIXUMRYEAGBBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO3/c3-2(4)1-6-5/h5H,1H2,(H2,3,4).
What are the key properties of 2-hydroperoxyacetamide?
2-hydroperoxyacetamide has a molecular weight of 91.07 g/mol, XLogP of -1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxyacetamide is sourced from PubChem (CID 53437904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).