C12H21N3O7 — CID 53463657
2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid (PubChem CID 53463657) has the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid.
| Compound Name | 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid |
|---|---|
| PubChem CID | 53463657 |
| Molecular Formula | C12H21N3O7 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid |
| SMILES | NC(CCC(=O)C(CCC(N)C(=O)O)C(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O7/c13-6(10(17)18)2-1-5(9(15)12(21)22)8(16)4-3-7(14)11(19)20/h5-7,9H,1-4,13-15H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | PARIWXLJGXMMNN-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 207.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |