2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid

C12H21N3O7 — CID 53463657

IUPAC2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid
SMILESNC(CCC(=O)C(CCC(N)C(=O)O)C(N)C(=O)O)C(=O)O
InChIInChI=1S/C12H21N3O7/c13-6(10(17)18)2-1-5(9(15)12(21)22)8(16)4-3-7(14)11(19)20/h5-7,9H,1-4,13-15H2,(H,17,18)(H,19,20)(H,21,22)
InChIKeyPARIWXLJGXMMNN-UHFFFAOYSA-N
MW319.31 g/mol
LogP-2.03
Rot. Bonds11

About 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid

2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid (PubChem CID 53463657) has the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid.

Molecular Properties

Compound Name2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid
PubChem CID53463657
Molecular FormulaC12H21N3O7
Molecular Weight319.31 g/mol
Exact Mass319.14
IUPAC Name2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid
SMILESNC(CCC(=O)C(CCC(N)C(=O)O)C(N)C(=O)O)C(=O)O
InChIInChI=1S/C12H21N3O7/c13-6(10(17)18)2-1-5(9(15)12(21)22)8(16)4-3-7(14)11(19)20/h5-7,9H,1-4,13-15H2,(H,17,18)(H,19,20)(H,21,22)
InChIKeyPARIWXLJGXMMNN-UHFFFAOYSA-N
XLogP-2.03
TPSA207.03 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds11
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500319.31
LogP ≤ 5-2.03
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Analyze 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid?
The IUPAC name of 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid (CID 53463657) is 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid.
What is the SMILES notation for 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid?
The canonical SMILES for 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid is NC(CCC(=O)C(CCC(N)C(=O)O)C(N)C(=O)O)C(=O)O.
What is the InChIKey of 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid?
The InChIKey is PARIWXLJGXMMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O7/c13-6(10(17)18)2-1-5(9(15)12(21)22)8(16)4-3-7(14)11(19)20/h5-7,9H,1-4,13-15H2,(H,17,18)(H,19,20)(H,21,22).
What are the key properties of 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid?
2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid has a molecular weight of 319.31 g/mol, XLogP of -2.03, 11 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diamino-5-[amino(carboxy)methyl]-6-oxodecanedioic acid is sourced from PubChem (CID 53463657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).