C15H33BrN3P — CID 53468322
bis(diethylamino)-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]-methylphosphanium bromide (PubChem CID 53468322) has the molecular formula C15H33BrN3P and a molecular weight of 366.33 g/mol. Its IUPAC name is bis(diethylamino)-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]-methylphosphanium bromide.
| Compound Name | bis(diethylamino)-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]-methylphosphanium bromide |
|---|---|
| PubChem CID | 53468322 |
| Molecular Formula | C15H33BrN3P |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | bis(diethylamino)-[(1E,3E)-4-(dimethylamino)buta-1,3-dienyl]-methylphosphanium bromide |
| SMILES | CCN(CC)[P+](C)(/C=C/C=C/N(C)C)N(CC)CC.[Br-] |
| InChI | InChI=1S/C15H33N3P.BrH/c1-8-17(9-2)19(7,18(10-3)11-4)15-13-12-14-16(5)6;/h12-15H,8-11H2,1-7H3;1H/q+1;/p-1/b14-12+,15-13+; |
| InChIKey | BCOBTNAPMGUIBD-ZUADHLFUSA-M |
| XLogP | 0.74 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|