C25H46O7Si — CID 53494210
(2E,7S,8E,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-bis(methoxymethoxy)pentadeca-2,8,14-trienoic acid (PubChem CID 53494210) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is (2E,7S,8E,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-bis(methoxymethoxy)pentadeca-2,8,14-trienoic acid.
| Compound Name | (2E,7S,8E,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-bis(methoxymethoxy)pentadeca-2,8,14-trienoic acid |
|---|---|
| PubChem CID | 53494210 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (2E,7S,8E,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-bis(methoxymethoxy)pentadeca-2,8,14-trienoic acid |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@H](CCC/C=C/C(=O)O)OCOC)OCOC |
| InChI | InChI=1S/C25H46O7Si/c1-9-10-15-23(32-33(7,8)25(2,3)4)22(31-20-29-6)18-17-21(30-19-28-5)14-12-11-13-16-24(26)27/h9,13,16-18,21-23H,1,10-12,14-15,19-20H2,2-8H3,(H,26,27)/b16-13+,18-17+/t21-,22-,23-/m0/s1 |
| InChIKey | WURWQXGLQHENSQ-PCQOJTDRSA-N |
| XLogP | 5.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|