C19H19F3N4 — CID 53494314
6-N,9-dimethyl-2-N-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine (PubChem CID 53494314) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 6-N,9-dimethyl-2-N-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine.
| Compound Name | 6-N,9-dimethyl-2-N-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
|---|---|
| PubChem CID | 53494314 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-N,9-dimethyl-2-N-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
| SMILES | CNC1CCc2c(c3ccc(Nc4cc(F)c(F)c(F)c4)nc3n2C)C1 |
| InChI | InChI=1S/C19H19F3N4/c1-23-10-3-5-16-13(7-10)12-4-6-17(25-19(12)26(16)2)24-11-8-14(20)18(22)15(21)9-11/h4,6,8-10,23H,3,5,7H2,1-2H3,(H,24,25) |
| InChIKey | LRTUDWVIQHCLHU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|