C12H10F12 — CID 5364385
(5Z)-6,7,7,8,8,9,9,10,10,11,11,11-dodecafluoro-3-methylundeca-1,5-diene (PubChem CID 5364385) has the molecular formula C12H10F12 and a molecular weight of 382.19 g/mol. Its IUPAC name is (5Z)-6,7,7,8,8,9,9,10,10,11,11,11-dodecafluoro-3-methylundeca-1,5-diene.
| Compound Name | (5Z)-6,7,7,8,8,9,9,10,10,11,11,11-dodecafluoro-3-methylundeca-1,5-diene |
|---|---|
| PubChem CID | 5364385 |
| Molecular Formula | C12H10F12 |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (5Z)-6,7,7,8,8,9,9,10,10,11,11,11-dodecafluoro-3-methylundeca-1,5-diene |
| SMILES | C=CC(C)C/C=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F12/c1-3-6(2)4-5-7(13)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)24/h3,5-6H,1,4H2,2H3/b7-5- |
| InChIKey | GKAKSWZINMYCFS-ALCCZGGFSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|