C24H32O2 — CID 5384599
(3Z)-3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]oxolan-2-one (PubChem CID 5384599) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (3Z)-3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]oxolan-2-one.
| Compound Name | (3Z)-3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]oxolan-2-one |
|---|---|
| PubChem CID | 5384599 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3Z)-3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]oxolan-2-one |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=C/C=C1/CCOC1=O |
| InChI | InChI=1S/C24H32O2/c1-18(11-13-21-15-17-26-23(21)25)8-6-9-19(2)12-14-22-20(3)10-7-16-24(22,4)5/h6,8-9,11-14H,7,10,15-17H2,1-5H3/b8-6?,14-12?,18-11?,19-9?,21-13- |
| InChIKey | PBXSMKUJTAPQBP-UUNVJTRLSA-N |
| XLogP | 6.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|