C8H8N2S2 — CID 54072851
4-methyl-N-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 54072851) has the molecular formula C8H8N2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-methyl-N-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 54072851 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 4-methyl-N-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(Nc2cccs2)n1 |
| InChI | InChI=1S/C8H8N2S2/c1-6-5-12-8(9-6)10-7-3-2-4-11-7/h2-5H,1H3,(H,9,10) |
| InChIKey | MHRNOUPISOVASI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |